C16H14FN — CID 131886920
2-(4-fluorophenyl)-6,7-dimethyl-1H-indole (PubChem CID 131886920) has the molecular formula C16H14FN and a molecular weight of 239.29 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-6,7-dimethyl-1H-indole.
| Compound Name | 2-(4-fluorophenyl)-6,7-dimethyl-1H-indole |
|---|---|
| PubChem CID | 131886920 |
| Molecular Formula | C16H14FN |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2-(4-fluorophenyl)-6,7-dimethyl-1H-indole |
| SMILES | Cc1ccc2cc(-c3ccc(F)cc3)[nH]c2c1C |
| InChI | InChI=1S/C16H14FN/c1-10-3-4-13-9-15(18-16(13)11(10)2)12-5-7-14(17)8-6-12/h3-9,18H,1-2H3 |
| InChIKey | HDKNBURWGAQKFZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |