C17H17N — CID 131886944
5,7-dimethyl-2-(4-methylphenyl)-1H-indole (PubChem CID 131886944) has the molecular formula C17H17N and a molecular weight of 235.33 g/mol. Its IUPAC name is 5,7-dimethyl-2-(4-methylphenyl)-1H-indole.
| Compound Name | 5,7-dimethyl-2-(4-methylphenyl)-1H-indole |
|---|---|
| PubChem CID | 131886944 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 5,7-dimethyl-2-(4-methylphenyl)-1H-indole |
| SMILES | Cc1ccc(-c2cc3cc(C)cc(C)c3[nH]2)cc1 |
| InChI | InChI=1S/C17H17N/c1-11-4-6-14(7-5-11)16-10-15-9-12(2)8-13(3)17(15)18-16/h4-10,18H,1-3H3 |
| InChIKey | OUOCYKAYBWSCLG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |