C12H13N — CID 121007476
2-ethenyl-5,7-dimethyl-1H-indole (PubChem CID 121007476) has the molecular formula C12H13N and a molecular weight of 171.24 g/mol. Its IUPAC name is 2-ethenyl-5,7-dimethyl-1H-indole.
| Compound Name | 2-ethenyl-5,7-dimethyl-1H-indole |
|---|---|
| PubChem CID | 121007476 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 2-ethenyl-5,7-dimethyl-1H-indole |
| SMILES | C=Cc1cc2cc(C)cc(C)c2[nH]1 |
| InChI | InChI=1S/C12H13N/c1-4-11-7-10-6-8(2)5-9(3)12(10)13-11/h4-7,13H,1H2,2-3H3 |
| InChIKey | LFHVYJTWZCFWDU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |