C18H19N — CID 131886954
2-(2,5-dimethylphenyl)-5,7-dimethyl-1H-indole (PubChem CID 131886954) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-5,7-dimethyl-1H-indole.
| Compound Name | 2-(2,5-dimethylphenyl)-5,7-dimethyl-1H-indole |
|---|---|
| PubChem CID | 131886954 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-5,7-dimethyl-1H-indole |
| SMILES | Cc1ccc(C)c(-c2cc3cc(C)cc(C)c3[nH]2)c1 |
| InChI | InChI=1S/C18H19N/c1-11-5-6-13(3)16(9-11)17-10-15-8-12(2)7-14(4)18(15)19-17/h5-10,19H,1-4H3 |
| InChIKey | ZQOBRLUWYXBLGO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |