About 2-(2-bromophenyl)-5,7-dimethyl-1H-indole
2-(2-bromophenyl)-5,7-dimethyl-1H-indole (PubChem CID 131886941) has the molecular formula C16H14BrN
and a molecular weight of 300.20 g/mol. Its IUPAC name is 2-(2-bromophenyl)-5,7-dimethyl-1H-indole.
Molecular Properties
| Compound Name | 2-(2-bromophenyl)-5,7-dimethyl-1H-indole |
| PubChem CID | 131886941 |
| Molecular Formula | C16H14BrN |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 2-(2-bromophenyl)-5,7-dimethyl-1H-indole |
| SMILES | Cc1cc(C)c2[nH]c(-c3ccccc3Br)cc2c1 |
| InChI | InChI=1S/C16H14BrN/c1-10-7-11(2)16-12(8-10)9-15(18-16)13-5-3-4-6-14(13)17/h3-9,18H,1-2H3 |
| InChIKey | FUFQLPWPPIAZKV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-(2-bromophenyl)-5,7-dimethyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromophenyl)-5,7-dimethyl-1H-indole?
The IUPAC name of 2-(2-bromophenyl)-5,7-dimethyl-1H-indole (CID 131886941) is 2-(2-bromophenyl)-5,7-dimethyl-1H-indole.
What is the SMILES notation for 2-(2-bromophenyl)-5,7-dimethyl-1H-indole?
The canonical SMILES for 2-(2-bromophenyl)-5,7-dimethyl-1H-indole is Cc1cc(C)c2[nH]c(-c3ccccc3Br)cc2c1.
What is the InChIKey of 2-(2-bromophenyl)-5,7-dimethyl-1H-indole?
The InChIKey is FUFQLPWPPIAZKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14BrN/c1-10-7-11(2)16-12(8-10)9-15(18-16)13-5-3-4-6-14(13)17/h3-9,18H,1-2H3.
What are the key properties of 2-(2-bromophenyl)-5,7-dimethyl-1H-indole?
2-(2-bromophenyl)-5,7-dimethyl-1H-indole has a molecular weight of 300.20 g/mol, XLogP of 5.21, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromophenyl)-5,7-dimethyl-1H-indole is sourced from PubChem (CID 131886941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).