C11H15NS — CID 155374256
1,3-dimethyl-2-[(1E)-2-methylsulfanylbuta-1,3-dienyl]pyrrole (PubChem CID 155374256) has the molecular formula C11H15NS and a molecular weight of 193.31 g/mol. Its IUPAC name is 1,3-dimethyl-2-[(1E)-2-methylsulfanylbuta-1,3-dienyl]pyrrole.
| Compound Name | 1,3-dimethyl-2-[(1E)-2-methylsulfanylbuta-1,3-dienyl]pyrrole |
|---|---|
| PubChem CID | 155374256 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 1,3-dimethyl-2-[(1E)-2-methylsulfanylbuta-1,3-dienyl]pyrrole |
| SMILES | C=C/C(=C\c1c(C)ccn1C)SC |
| InChI | InChI=1S/C11H15NS/c1-5-10(13-4)8-11-9(2)6-7-12(11)3/h5-8H,1H2,2-4H3/b10-8+ |
| InChIKey | SAQLDZQIZXOZRS-CSKARUKUSA-N |
| XLogP | 3.22 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|