C15H14BrNO2S — CID 121291836
1-(benzenesulfonyl)-2-[(1E)-2-bromobuta-1,3-dienyl]-3-methylpyrrole (PubChem CID 121291836) has the molecular formula C15H14BrNO2S and a molecular weight of 352.25 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2-[(1E)-2-bromobuta-1,3-dienyl]-3-methylpyrrole.
| Compound Name | 1-(benzenesulfonyl)-2-[(1E)-2-bromobuta-1,3-dienyl]-3-methylpyrrole |
|---|---|
| PubChem CID | 121291836 |
| Molecular Formula | C15H14BrNO2S |
| Molecular Weight | 352.25 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | 1-(benzenesulfonyl)-2-[(1E)-2-bromobuta-1,3-dienyl]-3-methylpyrrole |
| SMILES | C=C/C(Br)=C\c1c(C)ccn1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H14BrNO2S/c1-3-13(16)11-15-12(2)9-10-17(15)20(18,19)14-7-5-4-6-8-14/h3-11H,1H2,2H3/b13-11+ |
| InChIKey | HCZNMMMXUDBIPI-ACCUITESSA-N |
| XLogP | 3.96 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.25 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|