C8H13N3 — CID 145323616
1-methyl-3-N-prop-2-enylpyrrole-2,3-diamine (PubChem CID 145323616) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 1-methyl-3-N-prop-2-enylpyrrole-2,3-diamine.
| Compound Name | 1-methyl-3-N-prop-2-enylpyrrole-2,3-diamine |
|---|---|
| PubChem CID | 145323616 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 1-methyl-3-N-prop-2-enylpyrrole-2,3-diamine |
| SMILES | C=CCNc1ccn(C)c1N |
| InChI | InChI=1S/C8H13N3/c1-3-5-10-7-4-6-11(2)8(7)9/h3-4,6,10H,1,5,9H2,2H3 |
| InChIKey | CRGJSDMKFLDJJA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 42.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|