About 1-methylindole;N-prop-2-enylprop-2-en-1-amine
1-methylindole;N-prop-2-enylprop-2-en-1-amine (PubChem CID 68614533) has the molecular formula C15H20N2
and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-methylindole;N-prop-2-enylprop-2-en-1-amine.
Molecular Properties
| Compound Name | 1-methylindole;N-prop-2-enylprop-2-en-1-amine |
| PubChem CID | 68614533 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 1-methylindole;N-prop-2-enylprop-2-en-1-amine |
| SMILES | C=CCNCC=C.Cn1ccc2ccccc21 |
| InChI | InChI=1S/C9H9N.C6H11N/c1-10-7-6-8-4-2-3-5-9(8)10;1-3-5-7-6-4-2/h2-7H,1H3;3-4,7H,1-2,5-6H2 |
| InChIKey | WPBXPHUAEOLIHB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methylindole;N-prop-2-enylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylindole;N-prop-2-enylprop-2-en-1-amine?
The IUPAC name of 1-methylindole;N-prop-2-enylprop-2-en-1-amine (CID 68614533) is 1-methylindole;N-prop-2-enylprop-2-en-1-amine.
What is the SMILES notation for 1-methylindole;N-prop-2-enylprop-2-en-1-amine?
The canonical SMILES for 1-methylindole;N-prop-2-enylprop-2-en-1-amine is C=CCNCC=C.Cn1ccc2ccccc21.
What is the InChIKey of 1-methylindole;N-prop-2-enylprop-2-en-1-amine?
The InChIKey is WPBXPHUAEOLIHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.C6H11N/c1-10-7-6-8-4-2-3-5-9(8)10;1-3-5-7-6-4-2/h2-7H,1H3;3-4,7H,1-2,5-6H2.
What are the key properties of 1-methylindole;N-prop-2-enylprop-2-en-1-amine?
1-methylindole;N-prop-2-enylprop-2-en-1-amine has a molecular weight of 228.34 g/mol, XLogP of 3.13, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylindole;N-prop-2-enylprop-2-en-1-amine is sourced from PubChem (CID 68614533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).