C12H16N2O — CID 157183236
N,N-dimethylformamide;1-methylindole (PubChem CID 157183236) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is N,N-dimethylformamide;1-methylindole.
| Compound Name | N,N-dimethylformamide;1-methylindole |
|---|---|
| PubChem CID | 157183236 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | N,N-dimethylformamide;1-methylindole |
| SMILES | CN(C)C=O.Cn1ccc2ccccc21 |
| InChI | InChI=1S/C9H9N.C3H7NO/c1-10-7-6-8-4-2-3-5-9(8)10;1-4(2)3-5/h2-7H,1H3;3H,1-2H3 |
| InChIKey | AOUPEGQTMMSJRX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|