About bromoethane;1-methylindole
bromoethane;1-methylindole (PubChem CID 90687414) has the molecular formula C11H14BrN
and a molecular weight of 240.14 g/mol. Its IUPAC name is bromoethane;1-methylindole.
Molecular Properties
| Compound Name | bromoethane;1-methylindole |
| PubChem CID | 90687414 |
| Molecular Formula | C11H14BrN |
| Molecular Weight | 240.14 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | bromoethane;1-methylindole |
| SMILES | CCBr.Cn1ccc2ccccc21 |
| InChI | InChI=1S/C9H9N.C2H5Br/c1-10-7-6-8-4-2-3-5-9(8)10;1-2-3/h2-7H,1H3;2H2,1H3 |
| InChIKey | ARTPEAOBVSLSFZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.14 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bromoethane;1-methylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromoethane;1-methylindole?
The IUPAC name of bromoethane;1-methylindole (CID 90687414) is bromoethane;1-methylindole.
What is the SMILES notation for bromoethane;1-methylindole?
The canonical SMILES for bromoethane;1-methylindole is CCBr.Cn1ccc2ccccc21.
What is the InChIKey of bromoethane;1-methylindole?
The InChIKey is ARTPEAOBVSLSFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.C2H5Br/c1-10-7-6-8-4-2-3-5-9(8)10;1-2-3/h2-7H,1H3;2H2,1H3.
What are the key properties of bromoethane;1-methylindole?
bromoethane;1-methylindole has a molecular weight of 240.14 g/mol, XLogP of 3.58, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromoethane;1-methylindole is sourced from PubChem (CID 90687414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).