About 1-methylindole;bis(triethyl-(1-methylindol-2-yl)silane)
1-methylindole;bis(triethyl-(1-methylindol-2-yl)silane) (PubChem CID 159581011) has the molecular formula C39H55N3Si2
and a molecular weight of 622.06 g/mol. Its IUPAC name is 1-methylindole;bis(triethyl-(1-methylindol-2-yl)silane).
Molecular Properties
| Compound Name | 1-methylindole;bis(triethyl-(1-methylindol-2-yl)silane) |
| PubChem CID | 159581011 |
| Molecular Formula | C39H55N3Si2 |
| Molecular Weight | 622.06 g/mol |
| Exact Mass | 621.39 |
| IUPAC Name | 1-methylindole;bis(triethyl-(1-methylindol-2-yl)silane) |
| SMILES | CC[Si](CC)(CC)c1cc2ccccc2n1C.CC[Si](CC)(CC)c1cc2ccccc2n1C.Cn1ccc2ccccc21 |
| InChI | InChI=1S/2C15H23NSi.C9H9N/c2*1-5-17(6-2,7-3)15-12-13-10-8-9-11-14(13)16(15)4;1-10-7-6-8-4-2-3-5-9(8)10/h2*8-12H,5-7H2,1-4H3;2-7H,1H3 |
| InChIKey | MIZZURHDHYDKAQ-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 14.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 622.06 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-methylindole;bis(triethyl-(1-methylindol-2-yl)silane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylindole;bis(triethyl-(1-methylindol-2-yl)silane)?
The IUPAC name of 1-methylindole;bis(triethyl-(1-methylindol-2-yl)silane) (CID 159581011) is 1-methylindole;bis(triethyl-(1-methylindol-2-yl)silane).
What is the SMILES notation for 1-methylindole;bis(triethyl-(1-methylindol-2-yl)silane)?
The canonical SMILES for 1-methylindole;bis(triethyl-(1-methylindol-2-yl)silane) is CC[Si](CC)(CC)c1cc2ccccc2n1C.CC[Si](CC)(CC)c1cc2ccccc2n1C.Cn1ccc2ccccc21.
What is the InChIKey of 1-methylindole;bis(triethyl-(1-methylindol-2-yl)silane)?
The InChIKey is MIZZURHDHYDKAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H23NSi.C9H9N/c2*1-5-17(6-2,7-3)15-12-13-10-8-9-11-14(13)16(15)4;1-10-7-6-8-4-2-3-5-9(8)10/h2*8-12H,5-7H2,1-4H3;2-7H,1H3.
What are the key properties of 1-methylindole;bis(triethyl-(1-methylindol-2-yl)silane)?
1-methylindole;bis(triethyl-(1-methylindol-2-yl)silane) has a molecular weight of 622.06 g/mol, XLogP of 9.97, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylindole;bis(triethyl-(1-methylindol-2-yl)silane) is sourced from PubChem (CID 159581011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).