About ethane;1-methylindole
ethane;1-methylindole (PubChem CID 91600075) has the molecular formula C15H27N
and a molecular weight of 221.39 g/mol. Its IUPAC name is ethane;1-methylindole.
Molecular Properties
| Compound Name | ethane;1-methylindole |
| PubChem CID | 91600075 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | ethane;1-methylindole |
| SMILES | CC.CC.CC.Cn1ccc2ccccc21 |
| InChI | InChI=1S/C9H9N.3C2H6/c1-10-7-6-8-4-2-3-5-9(8)10;3*1-2/h2-7H,1H3;3*1-2H3 |
| InChIKey | STTRQPAOEYLWRU-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1-methylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methylindole?
The IUPAC name of ethane;1-methylindole (CID 91600075) is ethane;1-methylindole.
What is the SMILES notation for ethane;1-methylindole?
The canonical SMILES for ethane;1-methylindole is CC.CC.CC.Cn1ccc2ccccc21.
What is the InChIKey of ethane;1-methylindole?
The InChIKey is STTRQPAOEYLWRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.3C2H6/c1-10-7-6-8-4-2-3-5-9(8)10;3*1-2/h2-7H,1H3;3*1-2H3.
What are the key properties of ethane;1-methylindole?
ethane;1-methylindole has a molecular weight of 221.39 g/mol, XLogP of 5.26, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methylindole is sourced from PubChem (CID 91600075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).