C18H17NO4 — CID 158400940
2-methylbenzene-1,3-dicarboxylic acid;1-methylindole (PubChem CID 158400940) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is 2-methylbenzene-1,3-dicarboxylic acid;1-methylindole.
| Compound Name | 2-methylbenzene-1,3-dicarboxylic acid;1-methylindole |
|---|---|
| PubChem CID | 158400940 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 2-methylbenzene-1,3-dicarboxylic acid;1-methylindole |
| SMILES | Cc1c(C(=O)O)cccc1C(=O)O.Cn1ccc2ccccc21 |
| InChI | InChI=1S/C9H9N.C9H8O4/c1-10-7-6-8-4-2-3-5-9(8)10;1-5-6(8(10)11)3-2-4-7(5)9(12)13/h2-7H,1H3;2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | GYCANRVWLSRDEA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |