About ethane;1-methylindole;1-methyltriphenylene
ethane;1-methylindole;1-methyltriphenylene (PubChem CID 159697766) has the molecular formula C38H53N
and a molecular weight of 523.85 g/mol. Its IUPAC name is ethane;1-methylindole;1-methyltriphenylene.
Molecular Properties
| Compound Name | ethane;1-methylindole;1-methyltriphenylene |
| PubChem CID | 159697766 |
| Molecular Formula | C38H53N |
| Molecular Weight | 523.85 g/mol |
| Exact Mass | 523.42 |
| IUPAC Name | ethane;1-methylindole;1-methyltriphenylene |
| SMILES | CC.CC.CC.CC.CC.Cc1cccc2c3ccccc3c3ccccc3c12.Cn1ccc2ccccc21 |
| InChI | InChI=1S/C19H14.C9H9N.5C2H6/c1-13-7-6-12-18-16-9-3-2-8-14(16)15-10-4-5-11-17(15)19(13)18;1-10-7-6-8-4-2-3-5-9(8)10;5*1-2/h2-12H,1H3;2-7H,1H3;5*1-2H3 |
| InChIKey | MXFRAZZXTNJCTG-UHFFFAOYSA-N |
| XLogP | 12.76 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 523.85 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-methylindole;1-methyltriphenylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methylindole;1-methyltriphenylene?
The IUPAC name of ethane;1-methylindole;1-methyltriphenylene (CID 159697766) is ethane;1-methylindole;1-methyltriphenylene.
What is the SMILES notation for ethane;1-methylindole;1-methyltriphenylene?
The canonical SMILES for ethane;1-methylindole;1-methyltriphenylene is CC.CC.CC.CC.CC.Cc1cccc2c3ccccc3c3ccccc3c12.Cn1ccc2ccccc21.
What is the InChIKey of ethane;1-methylindole;1-methyltriphenylene?
The InChIKey is MXFRAZZXTNJCTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14.C9H9N.5C2H6/c1-13-7-6-12-18-16-9-3-2-8-14(16)15-10-4-5-11-17(15)19(13)18;1-10-7-6-8-4-2-3-5-9(8)10;5*1-2/h2-12H,1H3;2-7H,1H3;5*1-2H3.
What are the key properties of ethane;1-methylindole;1-methyltriphenylene?
ethane;1-methylindole;1-methyltriphenylene has a molecular weight of 523.85 g/mol, XLogP of 12.76, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methylindole;1-methyltriphenylene is sourced from PubChem (CID 159697766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).