About 1,5-dimethylquinolin-4-one
1,5-dimethylquinolin-4-one (PubChem CID 138533371) has the molecular formula C11H11NO
and a molecular weight of 173.21 g/mol. Its IUPAC name is 1,5-dimethylquinolin-4-one.
Molecular Properties
| Compound Name | 1,5-dimethylquinolin-4-one |
| PubChem CID | 138533371 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 1,5-dimethylquinolin-4-one |
| SMILES | Cc1cccc2c1c(=O)ccn2C |
| InChI | InChI=1S/C11H11NO/c1-8-4-3-5-9-11(8)10(13)6-7-12(9)2/h3-7H,1-2H3 |
| InChIKey | NNPSZHDSHWCIND-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,5-dimethylquinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethylquinolin-4-one?
The IUPAC name of 1,5-dimethylquinolin-4-one (CID 138533371) is 1,5-dimethylquinolin-4-one.
What is the SMILES notation for 1,5-dimethylquinolin-4-one?
The canonical SMILES for 1,5-dimethylquinolin-4-one is Cc1cccc2c1c(=O)ccn2C.
What is the InChIKey of 1,5-dimethylquinolin-4-one?
The InChIKey is NNPSZHDSHWCIND-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO/c1-8-4-3-5-9-11(8)10(13)6-7-12(9)2/h3-7H,1-2H3.
What are the key properties of 1,5-dimethylquinolin-4-one?
1,5-dimethylquinolin-4-one has a molecular weight of 173.21 g/mol, XLogP of 1.85, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethylquinolin-4-one is sourced from PubChem (CID 138533371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).