About 1-methylindole;naphthalene-1,4-dione
1-methylindole;naphthalene-1,4-dione (PubChem CID 175045014) has the molecular formula C19H15NO2
and a molecular weight of 289.33 g/mol. Its IUPAC name is 1-methylindole;naphthalene-1,4-dione.
Molecular Properties
| Compound Name | 1-methylindole;naphthalene-1,4-dione |
| PubChem CID | 175045014 |
| Molecular Formula | C19H15NO2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 1-methylindole;naphthalene-1,4-dione |
| SMILES | Cn1ccc2ccccc21.O=C1C=CC(=O)c2ccccc21 |
| InChI | InChI=1S/C10H6O2.C9H9N/c11-9-5-6-10(12)8-4-2-1-3-7(8)9;1-10-7-6-8-4-2-3-5-9(8)10/h1-6H;2-7H,1H3 |
| InChIKey | RPGVRULUJOCDKT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 1-methylindole;naphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylindole;naphthalene-1,4-dione?
The IUPAC name of 1-methylindole;naphthalene-1,4-dione (CID 175045014) is 1-methylindole;naphthalene-1,4-dione.
What is the SMILES notation for 1-methylindole;naphthalene-1,4-dione?
The canonical SMILES for 1-methylindole;naphthalene-1,4-dione is Cn1ccc2ccccc21.O=C1C=CC(=O)c2ccccc21.
What is the InChIKey of 1-methylindole;naphthalene-1,4-dione?
The InChIKey is RPGVRULUJOCDKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6O2.C9H9N/c11-9-5-6-10(12)8-4-2-1-3-7(8)9;1-10-7-6-8-4-2-3-5-9(8)10/h1-6H;2-7H,1H3.
What are the key properties of 1-methylindole;naphthalene-1,4-dione?
1-methylindole;naphthalene-1,4-dione has a molecular weight of 289.33 g/mol, XLogP of 3.80, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylindole;naphthalene-1,4-dione is sourced from PubChem (CID 175045014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).