About ethane;1-methylindole;N-methylmethanamine
ethane;1-methylindole;N-methylmethanamine (PubChem CID 54113940) has the molecular formula C13H22N2
and a molecular weight of 206.33 g/mol. Its IUPAC name is ethane;1-methylindole;N-methylmethanamine.
Molecular Properties
| Compound Name | ethane;1-methylindole;N-methylmethanamine |
| PubChem CID | 54113940 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | ethane;1-methylindole;N-methylmethanamine |
| SMILES | CC.CNC.Cn1ccc2ccccc21 |
| InChI | InChI=1S/C9H9N.C2H7N.C2H6/c1-10-7-6-8-4-2-3-5-9(8)10;1-3-2;1-2/h2-7H,1H3;3H,1-2H3;1-2H3 |
| InChIKey | NJAFKNSZWLSNIC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-methylindole;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methylindole;N-methylmethanamine?
The IUPAC name of ethane;1-methylindole;N-methylmethanamine (CID 54113940) is ethane;1-methylindole;N-methylmethanamine.
What is the SMILES notation for ethane;1-methylindole;N-methylmethanamine?
The canonical SMILES for ethane;1-methylindole;N-methylmethanamine is CC.CNC.Cn1ccc2ccccc21.
What is the InChIKey of ethane;1-methylindole;N-methylmethanamine?
The InChIKey is NJAFKNSZWLSNIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.C2H7N.C2H6/c1-10-7-6-8-4-2-3-5-9(8)10;1-3-2;1-2/h2-7H,1H3;3H,1-2H3;1-2H3.
What are the key properties of ethane;1-methylindole;N-methylmethanamine?
ethane;1-methylindole;N-methylmethanamine has a molecular weight of 206.33 g/mol, XLogP of 3.04, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methylindole;N-methylmethanamine is sourced from PubChem (CID 54113940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).