About ethane;1-methylindole;oxalyl dichloride
ethane;1-methylindole;oxalyl dichloride (PubChem CID 90879364) has the molecular formula C15H21Cl2NO2
and a molecular weight of 318.24 g/mol. Its IUPAC name is ethane;1-methylindole;oxalyl dichloride.
Molecular Properties
| Compound Name | ethane;1-methylindole;oxalyl dichloride |
| PubChem CID | 90879364 |
| Molecular Formula | C15H21Cl2NO2 |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | ethane;1-methylindole;oxalyl dichloride |
| SMILES | CC.CC.Cn1ccc2ccccc21.O=C(Cl)C(=O)Cl |
| InChI | InChI=1S/C9H9N.C2Cl2O2.2C2H6/c1-10-7-6-8-4-2-3-5-9(8)10;3-1(5)2(4)6;2*1-2/h2-7H,1H3;;2*1-2H3 |
| InChIKey | AMVHYHFYKROSEF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-methylindole;oxalyl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methylindole;oxalyl dichloride?
The IUPAC name of ethane;1-methylindole;oxalyl dichloride (CID 90879364) is ethane;1-methylindole;oxalyl dichloride.
What is the SMILES notation for ethane;1-methylindole;oxalyl dichloride?
The canonical SMILES for ethane;1-methylindole;oxalyl dichloride is CC.CC.Cn1ccc2ccccc21.O=C(Cl)C(=O)Cl.
What is the InChIKey of ethane;1-methylindole;oxalyl dichloride?
The InChIKey is AMVHYHFYKROSEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.C2Cl2O2.2C2H6/c1-10-7-6-8-4-2-3-5-9(8)10;3-1(5)2(4)6;2*1-2/h2-7H,1H3;;2*1-2H3.
What are the key properties of ethane;1-methylindole;oxalyl dichloride?
ethane;1-methylindole;oxalyl dichloride has a molecular weight of 318.24 g/mol, XLogP of 4.75, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methylindole;oxalyl dichloride is sourced from PubChem (CID 90879364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).