4-methyl-1,3-oxazole-5-carbonyl chloride

C5H4ClNO2 — CID 2795217

IUPAC4-methyl-1,3-oxazole-5-carbonyl chloride
SMILESCc1ncoc1C(=O)Cl
InChIInChI=1S/C5H4ClNO2/c1-3-4(5(6)8)9-2-7-3/h2H,1H3
InChIKeyYPKNOSGIABPXKS-UHFFFAOYSA-N
MW145.55 g/mol
LogP1.36
Rot. Bonds1

About 4-methyl-1,3-oxazole-5-carbonyl chloride

4-methyl-1,3-oxazole-5-carbonyl chloride (PubChem CID 2795217) has the molecular formula C5H4ClNO2 and a molecular weight of 145.55 g/mol. Its IUPAC name is 4-methyl-1,3-oxazole-5-carbonyl chloride.

Molecular Properties

Compound Name4-methyl-1,3-oxazole-5-carbonyl chloride
PubChem CID2795217
Molecular FormulaC5H4ClNO2
Molecular Weight145.55 g/mol
Exact Mass144.99
IUPAC Name4-methyl-1,3-oxazole-5-carbonyl chloride
SMILESCc1ncoc1C(=O)Cl
InChIInChI=1S/C5H4ClNO2/c1-3-4(5(6)8)9-2-7-3/h2H,1H3
InChIKeyYPKNOSGIABPXKS-UHFFFAOYSA-N
XLogP1.36
TPSA43.10 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500145.55
LogP ≤ 51.36
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 4-methyl-1,3-oxazole-5-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methyl-1,3-oxazole-5-carbonyl chloride?
The IUPAC name of 4-methyl-1,3-oxazole-5-carbonyl chloride (CID 2795217) is 4-methyl-1,3-oxazole-5-carbonyl chloride.
What is the SMILES notation for 4-methyl-1,3-oxazole-5-carbonyl chloride?
The canonical SMILES for 4-methyl-1,3-oxazole-5-carbonyl chloride is Cc1ncoc1C(=O)Cl.
What is the InChIKey of 4-methyl-1,3-oxazole-5-carbonyl chloride?
The InChIKey is YPKNOSGIABPXKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4ClNO2/c1-3-4(5(6)8)9-2-7-3/h2H,1H3.
What are the key properties of 4-methyl-1,3-oxazole-5-carbonyl chloride?
4-methyl-1,3-oxazole-5-carbonyl chloride has a molecular weight of 145.55 g/mol, XLogP of 1.36, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,3-oxazole-5-carbonyl chloride is sourced from PubChem (CID 2795217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).