C5H4ClNO2 — CID 2795217
4-methyl-1,3-oxazole-5-carbonyl chloride (PubChem CID 2795217) has the molecular formula C5H4ClNO2 and a molecular weight of 145.55 g/mol. Its IUPAC name is 4-methyl-1,3-oxazole-5-carbonyl chloride.
| Compound Name | 4-methyl-1,3-oxazole-5-carbonyl chloride |
|---|---|
| PubChem CID | 2795217 |
| Molecular Formula | C5H4ClNO2 |
| Molecular Weight | 145.55 g/mol |
| Exact Mass | 144.99 |
| IUPAC Name | 4-methyl-1,3-oxazole-5-carbonyl chloride |
| SMILES | Cc1ncoc1C(=O)Cl |
| InChI | InChI=1S/C5H4ClNO2/c1-3-4(5(6)8)9-2-7-3/h2H,1H3 |
| InChIKey | YPKNOSGIABPXKS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.55 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|