C7H10N2O2 — CID 79487198
N,N,4-trimethyl-1,3-oxazole-5-carboxamide (PubChem CID 79487198) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is N,N,4-trimethyl-1,3-oxazole-5-carboxamide.
| Compound Name | N,N,4-trimethyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 79487198 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | N,N,4-trimethyl-1,3-oxazole-5-carboxamide |
| SMILES | Cc1ncoc1C(=O)N(C)C |
| InChI | InChI=1S/C7H10N2O2/c1-5-6(11-4-8-5)7(10)9(2)3/h4H,1-3H3 |
| InChIKey | MKYCJRBPXJQIPP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |