C10H12N2O2 — CID 104581007
4-methyl-N-pent-3-ynyl-1,3-oxazole-5-carboxamide (PubChem CID 104581007) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 4-methyl-N-pent-3-ynyl-1,3-oxazole-5-carboxamide.
| Compound Name | 4-methyl-N-pent-3-ynyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 104581007 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 4-methyl-N-pent-3-ynyl-1,3-oxazole-5-carboxamide |
| SMILES | CC#CCCNC(=O)c1ocnc1C |
| InChI | InChI=1S/C10H12N2O2/c1-3-4-5-6-11-10(13)9-8(2)12-7-14-9/h7H,5-6H2,1-2H3,(H,11,13) |
| InChIKey | CTDXQMLKAPZGLI-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|