C12H19BrN2O2 — CID 106288404
N-(2-bromo-3-ethylpentyl)-4-methyl-1,3-oxazole-5-carboxamide (PubChem CID 106288404) has the molecular formula C12H19BrN2O2 and a molecular weight of 303.20 g/mol. Its IUPAC name is N-(2-bromo-3-ethylpentyl)-4-methyl-1,3-oxazole-5-carboxamide.
| Compound Name | N-(2-bromo-3-ethylpentyl)-4-methyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 106288404 |
| Molecular Formula | C12H19BrN2O2 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | N-(2-bromo-3-ethylpentyl)-4-methyl-1,3-oxazole-5-carboxamide |
| SMILES | CCC(CC)C(Br)CNC(=O)c1ocnc1C |
| InChI | InChI=1S/C12H19BrN2O2/c1-4-9(5-2)10(13)6-14-12(16)11-8(3)15-7-17-11/h7,9-10H,4-6H2,1-3H3,(H,14,16) |
| InChIKey | VMWWITLPEXFWTR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|