C13H21BrN2OS — CID 114168808
N-(2-bromo-3-ethylpentyl)-2,4-dimethyl-1,3-thiazole-5-carboxamide (PubChem CID 114168808) has the molecular formula C13H21BrN2OS and a molecular weight of 333.30 g/mol. Its IUPAC name is N-(2-bromo-3-ethylpentyl)-2,4-dimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-bromo-3-ethylpentyl)-2,4-dimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 114168808 |
| Molecular Formula | C13H21BrN2OS |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | N-(2-bromo-3-ethylpentyl)-2,4-dimethyl-1,3-thiazole-5-carboxamide |
| SMILES | CCC(CC)C(Br)CNC(=O)c1sc(C)nc1C |
| InChI | InChI=1S/C13H21BrN2OS/c1-5-10(6-2)11(14)7-15-13(17)12-8(3)16-9(4)18-12/h10-11H,5-7H2,1-4H3,(H,15,17) |
| InChIKey | CFYVWFWLQPUXGF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|