C13H11N3O2 — CID 79479305
N-(3-cyanophenyl)-N,4-dimethyl-1,3-oxazole-5-carboxamide (PubChem CID 79479305) has the molecular formula C13H11N3O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is N-(3-cyanophenyl)-N,4-dimethyl-1,3-oxazole-5-carboxamide.
| Compound Name | N-(3-cyanophenyl)-N,4-dimethyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 79479305 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | N-(3-cyanophenyl)-N,4-dimethyl-1,3-oxazole-5-carboxamide |
| SMILES | Cc1ncoc1C(=O)N(C)c1cccc(C#N)c1 |
| InChI | InChI=1S/C13H11N3O2/c1-9-12(18-8-15-9)13(17)16(2)11-5-3-4-10(6-11)7-14/h3-6,8H,1-2H3 |
| InChIKey | MBBMFKMHUQJMGZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 70.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |