C8H9NS2 — CID 129305603
(E)-1-(4-ethenyl-1,3-thiazol-5-yl)prop-1-ene-2-thiol (PubChem CID 129305603) has the molecular formula C8H9NS2 and a molecular weight of 183.30 g/mol. Its IUPAC name is (E)-1-(4-ethenyl-1,3-thiazol-5-yl)prop-1-ene-2-thiol.
| Compound Name | (E)-1-(4-ethenyl-1,3-thiazol-5-yl)prop-1-ene-2-thiol |
|---|---|
| PubChem CID | 129305603 |
| Molecular Formula | C8H9NS2 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | (E)-1-(4-ethenyl-1,3-thiazol-5-yl)prop-1-ene-2-thiol |
| SMILES | C=Cc1ncsc1/C=C(\C)S |
| InChI | InChI=1S/C8H9NS2/c1-3-7-8(4-6(2)10)11-5-9-7/h3-5,10H,1H2,2H3/b6-4+ |
| InChIKey | IFWWABGKPHHLDJ-GQCTYLIASA-N |
| XLogP | 3.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|