C11H17NS — CID 144533920
4,5-bis(prop-1-en-2-yl)-1,3-thiazole;ethane (PubChem CID 144533920) has the molecular formula C11H17NS and a molecular weight of 195.33 g/mol. Its IUPAC name is 4,5-bis(prop-1-en-2-yl)-1,3-thiazole;ethane.
| Compound Name | 4,5-bis(prop-1-en-2-yl)-1,3-thiazole;ethane |
|---|---|
| PubChem CID | 144533920 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 4,5-bis(prop-1-en-2-yl)-1,3-thiazole;ethane |
| SMILES | C=C(C)c1ncsc1C(=C)C.CC |
| InChI | InChI=1S/C9H11NS.C2H6/c1-6(2)8-9(7(3)4)11-5-10-8;1-2/h5H,1,3H2,2,4H3;1-2H3 |
| InChIKey | KGTROGQRFAYUOL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |