C7H9N3O2S — CID 140546289
5-N,5-N-dimethyl-1,3-thiazole-4,5-dicarboxamide (PubChem CID 140546289) has the molecular formula C7H9N3O2S and a molecular weight of 199.24 g/mol. Its IUPAC name is 5-N,5-N-dimethyl-1,3-thiazole-4,5-dicarboxamide.
| Compound Name | 5-N,5-N-dimethyl-1,3-thiazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 140546289 |
| Molecular Formula | C7H9N3O2S |
| Molecular Weight | 199.24 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | 5-N,5-N-dimethyl-1,3-thiazole-4,5-dicarboxamide |
| SMILES | CN(C)C(=O)c1scnc1C(N)=O |
| InChI | InChI=1S/C7H9N3O2S/c1-10(2)7(12)5-4(6(8)11)9-3-13-5/h3H,1-2H3,(H2,8,11) |
| InChIKey | ZEIGFJFUXJJJNA-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.24 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |