C6H5NO4S — CID 117214962
4-methoxycarbonyl-1,3-thiazole-5-carboxylic acid (PubChem CID 117214962) has the molecular formula C6H5NO4S and a molecular weight of 187.18 g/mol. Its IUPAC name is 4-methoxycarbonyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-methoxycarbonyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117214962 |
| Molecular Formula | C6H5NO4S |
| Molecular Weight | 187.18 g/mol |
| Exact Mass | 186.99 |
| IUPAC Name | 4-methoxycarbonyl-1,3-thiazole-5-carboxylic acid |
| SMILES | COC(=O)c1ncsc1C(=O)O |
| InChI | InChI=1S/C6H5NO4S/c1-11-6(10)3-4(5(8)9)12-2-7-3/h2H,1H3,(H,8,9) |
| InChIKey | PARUOHBIOSUCMG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.18 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |