C12H9NO5S — CID 117214754
5-(2-methoxyphenoxy)carbonyl-1,3-thiazole-4-carboxylic acid (PubChem CID 117214754) has the molecular formula C12H9NO5S and a molecular weight of 279.27 g/mol. Its IUPAC name is 5-(2-methoxyphenoxy)carbonyl-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-(2-methoxyphenoxy)carbonyl-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 117214754 |
| Molecular Formula | C12H9NO5S |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 5-(2-methoxyphenoxy)carbonyl-1,3-thiazole-4-carboxylic acid |
| SMILES | COc1ccccc1OC(=O)c1scnc1C(=O)O |
| InChI | InChI=1S/C12H9NO5S/c1-17-7-4-2-3-5-8(7)18-12(16)10-9(11(14)15)13-6-19-10/h2-6H,1H3,(H,14,15) |
| InChIKey | WCWSGBRHLKMJBO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|