About 4-carboxy-5-(2-methoxy-N-sulfinatoanilino)-1,3-thiazole
4-carboxy-5-(2-methoxy-N-sulfinatoanilino)-1,3-thiazole (PubChem CID 175456505) has the molecular formula C11H9N2O5S2-
and a molecular weight of 313.34 g/mol. Its IUPAC name is 4-carboxy-5-(2-methoxy-N-sulfinatoanilino)-1,3-thiazole.
Molecular Properties
| Compound Name | 4-carboxy-5-(2-methoxy-N-sulfinatoanilino)-1,3-thiazole |
| PubChem CID | 175456505 |
| Molecular Formula | C11H9N2O5S2- |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | 4-carboxy-5-(2-methoxy-N-sulfinatoanilino)-1,3-thiazole |
| SMILES | COc1ccccc1N(c1scnc1C(=O)O)S(=O)[O-] |
| InChI | InChI=1S/C11H10N2O5S2/c1-18-8-5-3-2-4-7(8)13(20(16)17)10-9(11(14)15)12-6-19-10/h2-6H,1H3,(H,14,15)(H,16,17)/p-1 |
| InChIKey | ONUAMRQFIYKVQZ-UHFFFAOYSA-M |
| XLogP | 1.78 |
| TPSA | 102.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 4-carboxy-5-(2-methoxy-N-sulfinatoanilino)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-carboxy-5-(2-methoxy-N-sulfinatoanilino)-1,3-thiazole?
The IUPAC name of 4-carboxy-5-(2-methoxy-N-sulfinatoanilino)-1,3-thiazole (CID 175456505) is 4-carboxy-5-(2-methoxy-N-sulfinatoanilino)-1,3-thiazole.
What is the SMILES notation for 4-carboxy-5-(2-methoxy-N-sulfinatoanilino)-1,3-thiazole?
The canonical SMILES for 4-carboxy-5-(2-methoxy-N-sulfinatoanilino)-1,3-thiazole is COc1ccccc1N(c1scnc1C(=O)O)S(=O)[O-].
What is the InChIKey of 4-carboxy-5-(2-methoxy-N-sulfinatoanilino)-1,3-thiazole?
The InChIKey is ONUAMRQFIYKVQZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H10N2O5S2/c1-18-8-5-3-2-4-7(8)13(20(16)17)10-9(11(14)15)12-6-19-10/h2-6H,1H3,(H,14,15)(H,16,17)/p-1.
What are the key properties of 4-carboxy-5-(2-methoxy-N-sulfinatoanilino)-1,3-thiazole?
4-carboxy-5-(2-methoxy-N-sulfinatoanilino)-1,3-thiazole has a molecular weight of 313.34 g/mol, XLogP of 1.78, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-carboxy-5-(2-methoxy-N-sulfinatoanilino)-1,3-thiazole is sourced from PubChem (CID 175456505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).