C19H16N2O4S2 — CID 175456518
5-[N-methylsulfonyl-2-(2-phenylethenyl)anilino]-1,3-thiazole-4-carboxylic acid (PubChem CID 175456518) has the molecular formula C19H16N2O4S2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 5-[N-methylsulfonyl-2-(2-phenylethenyl)anilino]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-[N-methylsulfonyl-2-(2-phenylethenyl)anilino]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 175456518 |
| Molecular Formula | C19H16N2O4S2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 5-[N-methylsulfonyl-2-(2-phenylethenyl)anilino]-1,3-thiazole-4-carboxylic acid |
| SMILES | CS(=O)(=O)N(c1ccccc1C=Cc1ccccc1)c1scnc1C(=O)O |
| InChI | InChI=1S/C19H16N2O4S2/c1-27(24,25)21(18-17(19(22)23)20-13-26-18)16-10-6-5-9-15(16)12-11-14-7-3-2-4-8-14/h2-13H,1H3,(H,22,23) |
| InChIKey | RYUWFTORFOIPIS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|