C11H10N2O5S2 — CID 175456506
5-(2-methoxy-N-sulfinoanilino)-1,3-thiazole-4-carboxylic acid (PubChem CID 175456506) has the molecular formula C11H10N2O5S2 and a molecular weight of 314.34 g/mol. Its IUPAC name is 5-(2-methoxy-N-sulfinoanilino)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-(2-methoxy-N-sulfinoanilino)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 175456506 |
| Molecular Formula | C11H10N2O5S2 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 5-(2-methoxy-N-sulfinoanilino)-1,3-thiazole-4-carboxylic acid |
| SMILES | COc1ccccc1N(c1scnc1C(=O)O)S(=O)O |
| InChI | InChI=1S/C11H10N2O5S2/c1-18-8-5-3-2-4-7(8)13(20(16)17)10-9(11(14)15)12-6-19-10/h2-6H,1H3,(H,14,15)(H,16,17) |
| InChIKey | ONUAMRQFIYKVQZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|