C18H20N3O6S2- — CID 175456464
4-carboxy-5-[(1-phenylmethoxycarbonylpiperidin-4-yl)methyl-sulfinatoamino]-1,3-thiazole (PubChem CID 175456464) has the molecular formula C18H20N3O6S2- and a molecular weight of 438.51 g/mol. Its IUPAC name is 4-carboxy-5-[(1-phenylmethoxycarbonylpiperidin-4-yl)methyl-sulfinatoamino]-1,3-thiazole.
| Compound Name | 4-carboxy-5-[(1-phenylmethoxycarbonylpiperidin-4-yl)methyl-sulfinatoamino]-1,3-thiazole |
|---|---|
| PubChem CID | 175456464 |
| Molecular Formula | C18H20N3O6S2- |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 4-carboxy-5-[(1-phenylmethoxycarbonylpiperidin-4-yl)methyl-sulfinatoamino]-1,3-thiazole |
| SMILES | O=C(O)c1ncsc1N(CC1CCN(C(=O)OCc2ccccc2)CC1)S(=O)[O-] |
| InChI | InChI=1S/C18H21N3O6S2/c22-17(23)15-16(28-12-19-15)21(29(25)26)10-13-6-8-20(9-7-13)18(24)27-11-14-4-2-1-3-5-14/h1-5,12-13H,6-11H2,(H,22,23)(H,25,26)/p-1 |
| InChIKey | ADHWXZZTRIQJFD-UHFFFAOYSA-M |
| XLogP | 2.49 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|