C12H11NO4S — CID 82133695
4-(3,4-dimethoxyphenyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 82133695) has the molecular formula C12H11NO4S and a molecular weight of 265.29 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-(3,4-dimethoxyphenyl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82133695 |
| Molecular Formula | C12H11NO4S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | COc1ccc(-c2ncsc2C(=O)O)cc1OC |
| InChI | InChI=1S/C12H11NO4S/c1-16-8-4-3-7(5-9(8)17-2)10-11(12(14)15)18-6-13-10/h3-6H,1-2H3,(H,14,15) |
| InChIKey | WALZSOJZUMUCQC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |