C11H6ClNO4S — CID 117214774
5-(4-chlorophenoxy)carbonyl-1,3-thiazole-4-carboxylic acid (PubChem CID 117214774) has the molecular formula C11H6ClNO4S and a molecular weight of 283.69 g/mol. Its IUPAC name is 5-(4-chlorophenoxy)carbonyl-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-(4-chlorophenoxy)carbonyl-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 117214774 |
| Molecular Formula | C11H6ClNO4S |
| Molecular Weight | 283.69 g/mol |
| Exact Mass | 282.97 |
| IUPAC Name | 5-(4-chlorophenoxy)carbonyl-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1ncsc1C(=O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H6ClNO4S/c12-6-1-3-7(4-2-6)17-11(16)9-8(10(14)15)13-5-18-9/h1-5H,(H,14,15) |
| InChIKey | BWRQLSJIKWMBAO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.69 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|