C11H6ClNO6S — CID 117215139
3-(4-chlorophenoxy)carbonyl-1,1-dioxo-1,2-thiazole-5-carboxylic acid (PubChem CID 117215139) has the molecular formula C11H6ClNO6S and a molecular weight of 315.69 g/mol. Its IUPAC name is 3-(4-chlorophenoxy)carbonyl-1,1-dioxo-1,2-thiazole-5-carboxylic acid.
| Compound Name | 3-(4-chlorophenoxy)carbonyl-1,1-dioxo-1,2-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117215139 |
| Molecular Formula | C11H6ClNO6S |
| Molecular Weight | 315.69 g/mol |
| Exact Mass | 314.96 |
| IUPAC Name | 3-(4-chlorophenoxy)carbonyl-1,1-dioxo-1,2-thiazole-5-carboxylic acid |
| SMILES | O=C(O)C1=CC(C(=O)Oc2ccc(Cl)cc2)=NS1(=O)=O |
| InChI | InChI=1S/C11H6ClNO6S/c12-6-1-3-7(4-2-6)19-11(16)8-5-9(10(14)15)20(17,18)13-8/h1-5H,(H,14,15) |
| InChIKey | KXGQSMSEXZTURB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.69 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|