C10H7ClN2O4S — CID 117213443
(4-chlorophenyl) 5-amino-1,1-dioxo-1,2-thiazole-4-carboxylate (PubChem CID 117213443) has the molecular formula C10H7ClN2O4S and a molecular weight of 286.70 g/mol. Its IUPAC name is (4-chlorophenyl) 5-amino-1,1-dioxo-1,2-thiazole-4-carboxylate.
| Compound Name | (4-chlorophenyl) 5-amino-1,1-dioxo-1,2-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 117213443 |
| Molecular Formula | C10H7ClN2O4S |
| Molecular Weight | 286.70 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | (4-chlorophenyl) 5-amino-1,1-dioxo-1,2-thiazole-4-carboxylate |
| SMILES | NC1=C(C(=O)Oc2ccc(Cl)cc2)C=NS1(=O)=O |
| InChI | InChI=1S/C10H7ClN2O4S/c11-6-1-3-7(4-2-6)17-10(14)8-5-13-18(15,16)9(8)12/h1-5H,12H2 |
| InChIKey | ORMVLEKTZCNVBB-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.70 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|