C11H10N2O5S — CID 117213447
(4-methoxyphenyl) 5-amino-1,1-dioxo-1,2-thiazole-4-carboxylate (PubChem CID 117213447) has the molecular formula C11H10N2O5S and a molecular weight of 282.28 g/mol. Its IUPAC name is (4-methoxyphenyl) 5-amino-1,1-dioxo-1,2-thiazole-4-carboxylate.
| Compound Name | (4-methoxyphenyl) 5-amino-1,1-dioxo-1,2-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 117213447 |
| Molecular Formula | C11H10N2O5S |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | (4-methoxyphenyl) 5-amino-1,1-dioxo-1,2-thiazole-4-carboxylate |
| SMILES | COc1ccc(OC(=O)C2=C(N)S(=O)(=O)N=C2)cc1 |
| InChI | InChI=1S/C11H10N2O5S/c1-17-7-2-4-8(5-3-7)18-11(14)9-6-13-19(15,16)10(9)12/h2-6H,12H2,1H3 |
| InChIKey | CNXSGMZQAGJQSS-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|