C11H10N2O2S — CID 117214674
(4-methylphenyl) 4-amino-1,3-thiazole-5-carboxylate (PubChem CID 117214674) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is (4-methylphenyl) 4-amino-1,3-thiazole-5-carboxylate.
| Compound Name | (4-methylphenyl) 4-amino-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 117214674 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | (4-methylphenyl) 4-amino-1,3-thiazole-5-carboxylate |
| SMILES | Cc1ccc(OC(=O)c2scnc2N)cc1 |
| InChI | InChI=1S/C11H10N2O2S/c1-7-2-4-8(5-3-7)15-11(14)9-10(12)13-6-16-9/h2-6H,12H2,1H3 |
| InChIKey | GMODHXMUSJCCIT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|