C12H9NO4S — CID 117214938
4-(3-methylphenoxy)carbonyl-1,3-thiazole-5-carboxylic acid (PubChem CID 117214938) has the molecular formula C12H9NO4S and a molecular weight of 263.27 g/mol. Its IUPAC name is 4-(3-methylphenoxy)carbonyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-(3-methylphenoxy)carbonyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117214938 |
| Molecular Formula | C12H9NO4S |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 4-(3-methylphenoxy)carbonyl-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1cccc(OC(=O)c2ncsc2C(=O)O)c1 |
| InChI | InChI=1S/C12H9NO4S/c1-7-3-2-4-8(5-7)17-12(16)9-10(11(14)15)18-6-13-9/h2-6H,1H3,(H,14,15) |
| InChIKey | CNFZXHRQZUIWAB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|