About CID 160713620
CID 160713620 (PubChem CID 160713620) has the molecular formula C10H7B2BrN2O4S2
and a molecular weight of 384.84 g/mol.
Molecular Properties
| Compound Name | CID 160713620 |
| PubChem CID | 160713620 |
| Molecular Formula | C10H7B2BrN2O4S2 |
| Molecular Weight | 384.84 g/mol |
| Exact Mass | 383.92 |
| IUPAC Name | — |
| SMILES | [B]c1sc(Br)nc1C(=O)OC.[B]c1scnc1C(=O)OC |
| InChI | InChI=1S/C5H3BBrNO2S.C5H4BNO2S/c1-10-4(9)2-3(6)11-5(7)8-2;1-9-5(8)3-4(6)10-2-7-3/h1H3;2H,1H3 |
| InChIKey | AQXQGUBLBRTWIF-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.84 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 160713620 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 160713620?
The IUPAC name of CID 160713620 (CID 160713620) is not available.
What is the SMILES notation for CID 160713620?
The canonical SMILES for CID 160713620 is [B]c1sc(Br)nc1C(=O)OC.[B]c1scnc1C(=O)OC.
What is the InChIKey of CID 160713620?
The InChIKey is AQXQGUBLBRTWIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3BBrNO2S.C5H4BNO2S/c1-10-4(9)2-3(6)11-5(7)8-2;1-9-5(8)3-4(6)10-2-7-3/h1H3;2H,1H3.
What are the key properties of CID 160713620?
CID 160713620 has a molecular weight of 384.84 g/mol, XLogP of 0.21, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 160713620 is sourced from PubChem (CID 160713620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).