About CID 156651434
CID 156651434 (PubChem CID 156651434) has the molecular formula C7H6BNO3
and a molecular weight of 162.94 g/mol.
Molecular Properties
| Compound Name | CID 156651434 |
| PubChem CID | 156651434 |
| Molecular Formula | C7H6BNO3 |
| Molecular Weight | 162.94 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(O)c(C(=O)OC)n1 |
| InChI | InChI=1S/C7H6BNO3/c1-12-7(11)6-4(10)2-3-5(8)9-6/h2-3,10H,1H3 |
| InChIKey | AGJNWMDCYNRDRC-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.94 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 156651434 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156651434?
The IUPAC name of CID 156651434 (CID 156651434) is not available.
What is the SMILES notation for CID 156651434?
The canonical SMILES for CID 156651434 is [B]c1ccc(O)c(C(=O)OC)n1.
What is the InChIKey of CID 156651434?
The InChIKey is AGJNWMDCYNRDRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BNO3/c1-12-7(11)6-4(10)2-3-5(8)9-6/h2-3,10H,1H3.
What are the key properties of CID 156651434?
CID 156651434 has a molecular weight of 162.94 g/mol, XLogP of -0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156651434 is sourced from PubChem (CID 156651434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).