C12H11NO2S — CID 53271159
methyl 5-(2-methylphenyl)-1,3-thiazole-4-carboxylate (PubChem CID 53271159) has the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. Its IUPAC name is methyl 5-(2-methylphenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 5-(2-methylphenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 53271159 |
| Molecular Formula | C12H11NO2S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | methyl 5-(2-methylphenyl)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1ncsc1-c1ccccc1C |
| InChI | InChI=1S/C12H11NO2S/c1-8-5-3-4-6-9(8)11-10(12(14)15-2)13-7-16-11/h3-7H,1-2H3 |
| InChIKey | WDVARELMIBMFRJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |