C11H9KN2O2S — CID 122156916
potassium 5-(2-methylanilino)-1,3-thiazole-4-carboxylate (PubChem CID 122156916) has the molecular formula C11H9KN2O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is potassium 5-(2-methylanilino)-1,3-thiazole-4-carboxylate.
| Compound Name | potassium 5-(2-methylanilino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 122156916 |
| Molecular Formula | C11H9KN2O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | potassium 5-(2-methylanilino)-1,3-thiazole-4-carboxylate |
| SMILES | Cc1ccccc1Nc1scnc1C(=O)[O-].[K+] |
| InChI | InChI=1S/C11H10N2O2S.K/c1-7-4-2-3-5-8(7)13-10-9(11(14)15)12-6-16-10;/h2-6,13H,1H3,(H,14,15);/q;+1/p-1 |
| InChIKey | IULICHWEFULGFR-UHFFFAOYSA-M |
| XLogP | -1.44 |
| TPSA | 65.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |