C14H22S — CID 143369504
2-[(1Z)-buta-1,3-dienyl]-5-methyl-3-propylthiophene;ethane (PubChem CID 143369504) has the molecular formula C14H22S and a molecular weight of 222.40 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-5-methyl-3-propylthiophene;ethane.
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-5-methyl-3-propylthiophene;ethane |
|---|---|
| PubChem CID | 143369504 |
| Molecular Formula | C14H22S |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-5-methyl-3-propylthiophene;ethane |
| SMILES | C=C/C=C\c1sc(C)cc1CCC.CC |
| InChI | InChI=1S/C12H16S.C2H6/c1-4-6-8-12-11(7-5-2)9-10(3)13-12;1-2/h4,6,8-9H,1,5,7H2,2-3H3;1-2H3/b8-6-; |
| InChIKey | AVNGCXQBNNZBIE-PHZXCRFESA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|