C15H25N3 — CID 143189850
4-[(1Z)-buta-1,3-dienyl]-N-ethyl-5-methyl-N-(3-methylbutyl)-1H-imidazol-2-amine (PubChem CID 143189850) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is 4-[(1Z)-buta-1,3-dienyl]-N-ethyl-5-methyl-N-(3-methylbutyl)-1H-imidazol-2-amine.
| Compound Name | 4-[(1Z)-buta-1,3-dienyl]-N-ethyl-5-methyl-N-(3-methylbutyl)-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 143189850 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | 4-[(1Z)-buta-1,3-dienyl]-N-ethyl-5-methyl-N-(3-methylbutyl)-1H-imidazol-2-amine |
| SMILES | C=C/C=C\c1nc(N(CC)CCC(C)C)[nH]c1C |
| InChI | InChI=1S/C15H25N3/c1-6-8-9-14-13(5)16-15(17-14)18(7-2)11-10-12(3)4/h6,8-9,12H,1,7,10-11H2,2-5H3,(H,16,17)/b9-8- |
| InChIKey | QIAMDLBSIMVFRO-HJWRWDBZSA-N |
| XLogP | 3.79 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|