C14H19N — CID 126703741
4-[(1Z)-buta-1,3-dienyl]-3-(3-methylbutyl)pyridine (PubChem CID 126703741) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 4-[(1Z)-buta-1,3-dienyl]-3-(3-methylbutyl)pyridine.
| Compound Name | 4-[(1Z)-buta-1,3-dienyl]-3-(3-methylbutyl)pyridine |
|---|---|
| PubChem CID | 126703741 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 4-[(1Z)-buta-1,3-dienyl]-3-(3-methylbutyl)pyridine |
| SMILES | C=C/C=C\c1ccncc1CCC(C)C |
| InChI | InChI=1S/C14H19N/c1-4-5-6-13-9-10-15-11-14(13)8-7-12(2)3/h4-6,9-12H,1,7-8H2,2-3H3/b6-5- |
| InChIKey | DFTWTUHMGCKDIY-WAYWQWQTSA-N |
| XLogP | 3.87 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|