C16H28N4O2 — CID 71943511
6-amino-1-butyl-5-[3-methylbutyl(prop-2-enyl)amino]pyrimidine-2,4-dione (PubChem CID 71943511) has the molecular formula C16H28N4O2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 6-amino-1-butyl-5-[3-methylbutyl(prop-2-enyl)amino]pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-butyl-5-[3-methylbutyl(prop-2-enyl)amino]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 71943511 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 6-amino-1-butyl-5-[3-methylbutyl(prop-2-enyl)amino]pyrimidine-2,4-dione |
| SMILES | C=CCN(CCC(C)C)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H28N4O2/c1-5-7-10-20-14(17)13(15(21)18-16(20)22)19(9-6-2)11-8-12(3)4/h6,12H,2,5,7-11,17H2,1,3-4H3,(H,18,21,22) |
| InChIKey | BWNAHZYSKDTUQY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|