C23H33N5O3S — CID 55591122
2-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-(2-methylpropyl)amino]-N-(2-prop-2-enylsulfanylphenyl)acetamide (PubChem CID 55591122) has the molecular formula C23H33N5O3S and a molecular weight of 459.62 g/mol. Its IUPAC name is 2-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-(2-methylpropyl)amino]-N-(2-prop-2-enylsulfanylphenyl)acetamide.
| Compound Name | 2-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-(2-methylpropyl)amino]-N-(2-prop-2-enylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 55591122 |
| Molecular Formula | C23H33N5O3S |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 2-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-(2-methylpropyl)amino]-N-(2-prop-2-enylsulfanylphenyl)acetamide |
| SMILES | C=CCSc1ccccc1NC(=O)CN(CC(C)C)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H33N5O3S/c1-5-7-12-28-21(24)20(22(30)26-23(28)31)27(14-16(3)4)15-19(29)25-17-10-8-9-11-18(17)32-13-6-2/h6,8-11,16H,2,5,7,12-15,24H2,1,3-4H3,(H,25,29)(H,26,30,31) |
| InChIKey | ZOICHTYMDOPALL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|